C15H16N2O2 — CID 98145126
(3E,6R)-6-methyl-3-[(E)-2-oxo-4-phenylbut-3-enylidene]piperazin-2-one (PubChem CID 98145126) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is (3E,6R)-6-methyl-3-[(E)-2-oxo-4-phenylbut-3-enylidene]piperazin-2-one.
| Compound Name | (3E,6R)-6-methyl-3-[(E)-2-oxo-4-phenylbut-3-enylidene]piperazin-2-one |
|---|---|
| PubChem CID | 98145126 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (3E,6R)-6-methyl-3-[(E)-2-oxo-4-phenylbut-3-enylidene]piperazin-2-one |
| SMILES | C[C@@H]1CN/C(=C/C(=O)/C=C/c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C15H16N2O2/c1-11-10-16-14(15(19)17-11)9-13(18)8-7-12-5-3-2-4-6-12/h2-9,11,16H,10H2,1H3,(H,17,19)/b8-7+,14-9+/t11-/m1/s1 |
| InChIKey | YRXGDBVKCXKTDH-SFCHGYPNSA-N |
| XLogP | 1.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|