C16H14O5 — CID 53247878
(5E)-3,4-dimethoxy-5-[(E)-2-oxo-4-phenylbut-3-enylidene]furan-2-one (PubChem CID 53247878) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is (5E)-3,4-dimethoxy-5-[(E)-2-oxo-4-phenylbut-3-enylidene]furan-2-one.
| Compound Name | (5E)-3,4-dimethoxy-5-[(E)-2-oxo-4-phenylbut-3-enylidene]furan-2-one |
|---|---|
| PubChem CID | 53247878 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | (5E)-3,4-dimethoxy-5-[(E)-2-oxo-4-phenylbut-3-enylidene]furan-2-one |
| SMILES | COC1=C(OC)/C(=C\C(=O)/C=C/c2ccccc2)OC1=O |
| InChI | InChI=1S/C16H14O5/c1-19-14-13(21-16(18)15(14)20-2)10-12(17)9-8-11-6-4-3-5-7-11/h3-10H,1-2H3/b9-8+,13-10+ |
| InChIKey | ILYKABFAPFIVPU-PEGOPYGQSA-N |
| XLogP | 2.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|