C19H22N2O3 — CID 54090920
2-[4-[4-[(5R)-5-(methoxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]cyclohexylidene]acetonitrile (PubChem CID 54090920) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-[4-[4-[(5R)-5-(methoxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]cyclohexylidene]acetonitrile.
| Compound Name | 2-[4-[4-[(5R)-5-(methoxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]cyclohexylidene]acetonitrile |
|---|---|
| PubChem CID | 54090920 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 2-[4-[4-[(5R)-5-(methoxymethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]cyclohexylidene]acetonitrile |
| SMILES | COC[C@H]1CN(c2ccc(C3CCC(=CC#N)CC3)cc2)C(=O)O1 |
| InChI | InChI=1S/C19H22N2O3/c1-23-13-18-12-21(19(22)24-18)17-8-6-16(7-9-17)15-4-2-14(3-5-15)10-11-20/h6-10,15,18H,2-5,12-13H2,1H3/b14-10-/t15?,18-/m1/s1 |
| InChIKey | MTUBFBUVVAWAFP-JKEGQENRSA-N |
| XLogP | 3.77 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|