C18H16O — CID 54090938
4,5-dimethyl-1-phenoxynaphthalene (PubChem CID 54090938) has the molecular formula C18H16O and a molecular weight of 248.32 g/mol. Its IUPAC name is 4,5-dimethyl-1-phenoxynaphthalene.
| Compound Name | 4,5-dimethyl-1-phenoxynaphthalene |
|---|---|
| PubChem CID | 54090938 |
| Molecular Formula | C18H16O |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 4,5-dimethyl-1-phenoxynaphthalene |
| SMILES | Cc1cccc2c(Oc3ccccc3)ccc(C)c12 |
| InChI | InChI=1S/C18H16O/c1-13-7-6-10-16-17(12-11-14(2)18(13)16)19-15-8-4-3-5-9-15/h3-12H,1-2H3 |
| InChIKey | MTUHRVMRNYCHQV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |