C14H13IO — CID 139655770
3-iodo-1,2-dimethyl-4-phenoxybenzene (PubChem CID 139655770) has the molecular formula C14H13IO and a molecular weight of 324.16 g/mol. Its IUPAC name is 3-iodo-1,2-dimethyl-4-phenoxybenzene.
| Compound Name | 3-iodo-1,2-dimethyl-4-phenoxybenzene |
|---|---|
| PubChem CID | 139655770 |
| Molecular Formula | C14H13IO |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 3-iodo-1,2-dimethyl-4-phenoxybenzene |
| SMILES | Cc1ccc(Oc2ccccc2)c(I)c1C |
| InChI | InChI=1S/C14H13IO/c1-10-8-9-13(14(15)11(10)2)16-12-6-4-3-5-7-12/h3-9H,1-2H3 |
| InChIKey | GHPDMGDOORJRIR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|