About 1,2,4-trimethyl-3,5-diphenoxybenzene
1,2,4-trimethyl-3,5-diphenoxybenzene (PubChem CID 141017491) has the molecular formula C21H20O2
and a molecular weight of 304.39 g/mol. Its IUPAC name is 1,2,4-trimethyl-3,5-diphenoxybenzene.
Molecular Properties
| Compound Name | 1,2,4-trimethyl-3,5-diphenoxybenzene |
| PubChem CID | 141017491 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1,2,4-trimethyl-3,5-diphenoxybenzene |
| SMILES | Cc1cc(Oc2ccccc2)c(C)c(Oc2ccccc2)c1C |
| InChI | InChI=1S/C21H20O2/c1-15-14-20(22-18-10-6-4-7-11-18)17(3)21(16(15)2)23-19-12-8-5-9-13-19/h4-14H,1-3H3 |
| InChIKey | QAFUQORTHKNPQD-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2,4-trimethyl-3,5-diphenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4-trimethyl-3,5-diphenoxybenzene?
The IUPAC name of 1,2,4-trimethyl-3,5-diphenoxybenzene (CID 141017491) is 1,2,4-trimethyl-3,5-diphenoxybenzene.
What is the SMILES notation for 1,2,4-trimethyl-3,5-diphenoxybenzene?
The canonical SMILES for 1,2,4-trimethyl-3,5-diphenoxybenzene is Cc1cc(Oc2ccccc2)c(C)c(Oc2ccccc2)c1C.
What is the InChIKey of 1,2,4-trimethyl-3,5-diphenoxybenzene?
The InChIKey is QAFUQORTHKNPQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20O2/c1-15-14-20(22-18-10-6-4-7-11-18)17(3)21(16(15)2)23-19-12-8-5-9-13-19/h4-14H,1-3H3.
What are the key properties of 1,2,4-trimethyl-3,5-diphenoxybenzene?
1,2,4-trimethyl-3,5-diphenoxybenzene has a molecular weight of 304.39 g/mol, XLogP of 6.20, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4-trimethyl-3,5-diphenoxybenzene is sourced from PubChem (CID 141017491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).