C8H12N2O3 — CID 54090984
ethyl 3-(5-oxo-1,2-dihydropyrazol-3-yl)propanoate (PubChem CID 54090984) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is ethyl 3-(5-oxo-1,2-dihydropyrazol-3-yl)propanoate.
| Compound Name | ethyl 3-(5-oxo-1,2-dihydropyrazol-3-yl)propanoate |
|---|---|
| PubChem CID | 54090984 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | ethyl 3-(5-oxo-1,2-dihydropyrazol-3-yl)propanoate |
| SMILES | CCOC(=O)CCc1cc(=O)[nH][nH]1 |
| InChI | InChI=1S/C8H12N2O3/c1-2-13-8(12)4-3-6-5-7(11)10-9-6/h5H,2-4H2,1H3,(H2,9,10,11) |
| InChIKey | MTVCOXXCHCIHHS-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |