C7H10N2O3 — CID 43831447
ethyl 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetate (PubChem CID 43831447) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is ethyl 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetate.
| Compound Name | ethyl 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetate |
|---|---|
| PubChem CID | 43831447 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | ethyl 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetate |
| SMILES | CCOC(=O)Cc1cc(=O)[nH][nH]1 |
| InChI | InChI=1S/C7H10N2O3/c1-2-12-7(11)4-5-3-6(10)9-8-5/h3H,2,4H2,1H3,(H2,8,9,10) |
| InChIKey | PQKVTISYHNBZSE-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |