C19H19N3O2 — CID 54091273
N-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)-N-pyridin-4-ylprop-2-enamide (PubChem CID 54091273) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)-N-pyridin-4-ylprop-2-enamide.
| Compound Name | N-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)-N-pyridin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 54091273 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-(4,4-dimethyl-2-oxo-1,3-dihydroquinolin-7-yl)-N-pyridin-4-ylprop-2-enamide |
| SMILES | C=CC(=O)N(c1ccncc1)c1ccc2c(c1)NC(=O)CC2(C)C |
| InChI | InChI=1S/C19H19N3O2/c1-4-18(24)22(13-7-9-20-10-8-13)14-5-6-15-16(11-14)21-17(23)12-19(15,2)3/h4-11H,1,12H2,2-3H3,(H,21,23) |
| InChIKey | MUALOZYYHBRBHW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|