C8H19N2O3P — CID 54091761
[4-(aminomethyl)-1-methylpiperidin-4-yl]methylphosphonic acid (PubChem CID 54091761) has the molecular formula C8H19N2O3P and a molecular weight of 222.22 g/mol. Its IUPAC name is [4-(aminomethyl)-1-methylpiperidin-4-yl]methylphosphonic acid.
| Compound Name | [4-(aminomethyl)-1-methylpiperidin-4-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 54091761 |
| Molecular Formula | C8H19N2O3P |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | [4-(aminomethyl)-1-methylpiperidin-4-yl]methylphosphonic acid |
| SMILES | CN1CCC(CN)(CP(=O)(O)O)CC1 |
| InChI | InChI=1S/C8H19N2O3P/c1-10-4-2-8(6-9,3-5-10)7-14(11,12)13/h2-7,9H2,1H3,(H2,11,12,13) |
| InChIKey | MUIOXEBRECRUKR-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|