C12H25NNa- — CID 177136872
sodium;4,4-di(ethyl)-1-methylpiperidine;ethane (PubChem CID 177136872) has the molecular formula C12H25NNa- and a molecular weight of 206.33 g/mol. Its IUPAC name is sodium;4,4-di(ethyl)-1-methylpiperidine;ethane.
| Compound Name | sodium;4,4-di(ethyl)-1-methylpiperidine;ethane |
|---|---|
| PubChem CID | 177136872 |
| Molecular Formula | C12H25NNa- |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.19 |
| IUPAC Name | sodium;4,4-di(ethyl)-1-methylpiperidine;ethane |
| SMILES | CC.[CH2-]CC1(C[CH2-])CCN(C)CC1.[Na+] |
| InChI | InChI=1S/C10H19N.C2H6.Na/c1-4-10(5-2)6-8-11(3)9-7-10;1-2;/h1-2,4-9H2,3H3;1-2H3;/q-2;;+1 |
| InChIKey | QOEXRRIZYKVTCU-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|