C13H19NO5 — CID 54093956
2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-3-methylbutaneperoxoic acid (PubChem CID 54093956) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-3-methylbutaneperoxoic acid.
| Compound Name | 2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-3-methylbutaneperoxoic acid |
|---|---|
| PubChem CID | 54093956 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-3-methylbutaneperoxoic acid |
| SMILES | CC(C)C(C(=O)OO)n1c(O)c2c(c1O)CCCC2 |
| InChI | InChI=1S/C13H19NO5/c1-7(2)10(13(17)19-18)14-11(15)8-5-3-4-6-9(8)12(14)16/h7,10,15-16,18H,3-6H2,1-2H3 |
| InChIKey | MVUBZBAJXGHJLH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|