C16H14N4 — CID 54094843
2,3,4-tris(1H-pyrrol-2-yl)-1H-pyrrole (PubChem CID 54094843) has the molecular formula C16H14N4 and a molecular weight of 262.32 g/mol. Its IUPAC name is 2,3,4-tris(1H-pyrrol-2-yl)-1H-pyrrole.
| Compound Name | 2,3,4-tris(1H-pyrrol-2-yl)-1H-pyrrole |
|---|---|
| PubChem CID | 54094843 |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2,3,4-tris(1H-pyrrol-2-yl)-1H-pyrrole |
| SMILES | c1c[nH]c(-c2c[nH]c(-c3ccc[nH]3)c2-c2ccc[nH]2)c1 |
| InChI | InChI=1S/C16H14N4/c1-4-12(17-7-1)11-10-20-16(14-6-3-9-19-14)15(11)13-5-2-8-18-13/h1-10,17-20H |
| InChIKey | MWJWXJJKOOCLQO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |