C12H14N4O2S2 — CID 54094897
2-methyl-3-(2-methylsulfanyl-2-pyridin-2-ylethyl)sulfanyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 54094897) has the molecular formula C12H14N4O2S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-methyl-3-(2-methylsulfanyl-2-pyridin-2-ylethyl)sulfanyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 2-methyl-3-(2-methylsulfanyl-2-pyridin-2-ylethyl)sulfanyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 54094897 |
| Molecular Formula | C12H14N4O2S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 2-methyl-3-(2-methylsulfanyl-2-pyridin-2-ylethyl)sulfanyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | CSC(CSc1nc(=O)c(=O)[nH]n1C)c1ccccn1 |
| InChI | InChI=1S/C12H14N4O2S2/c1-16-12(14-10(17)11(18)15-16)20-7-9(19-2)8-5-3-4-6-13-8/h3-6,9H,7H2,1-2H3,(H,15,18) |
| InChIKey | PQKZQFOSTDVFLF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|