C14H18N4O2S — CID 107784536
2-methyl-3-[2-(methylamino)-2-(3-methylphenyl)ethyl]sulfanyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107784536) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 2-methyl-3-[2-(methylamino)-2-(3-methylphenyl)ethyl]sulfanyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 2-methyl-3-[2-(methylamino)-2-(3-methylphenyl)ethyl]sulfanyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107784536 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-methyl-3-[2-(methylamino)-2-(3-methylphenyl)ethyl]sulfanyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | CNC(CSc1nc(=O)c(=O)[nH]n1C)c1cccc(C)c1 |
| InChI | InChI=1S/C14H18N4O2S/c1-9-5-4-6-10(7-9)11(15-2)8-21-14-16-12(19)13(20)17-18(14)3/h4-7,11,15H,8H2,1-3H3,(H,17,20) |
| InChIKey | XYIAVPOBLZCTEF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|