C25H35NO2 — CID 54094924
ethane;2-hydroxy-2-(2-methyl-3H-inden-1-yl)-N-(2-phenylpropan-2-yl)acetamide (PubChem CID 54094924) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is ethane;2-hydroxy-2-(2-methyl-3H-inden-1-yl)-N-(2-phenylpropan-2-yl)acetamide.
| Compound Name | ethane;2-hydroxy-2-(2-methyl-3H-inden-1-yl)-N-(2-phenylpropan-2-yl)acetamide |
|---|---|
| PubChem CID | 54094924 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | ethane;2-hydroxy-2-(2-methyl-3H-inden-1-yl)-N-(2-phenylpropan-2-yl)acetamide |
| SMILES | CC.CC.CC1=C(C(O)C(=O)NC(C)(C)c2ccccc2)c2ccccc2C1 |
| InChI | InChI=1S/C21H23NO2.2C2H6/c1-14-13-15-9-7-8-12-17(15)18(14)19(23)20(24)22-21(2,3)16-10-5-4-6-11-16;2*1-2/h4-12,19,23H,13H2,1-3H3,(H,22,24);2*1-2H3 |
| InChIKey | MWLHCEUNCKNGOJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |