C40H76O6 — CID 54102374
(5R)-5-[(1S)-1,2-dihydroxyethyl]-4-(7,8,8-trihexylhexadecan-7-yloxy)oxolane-2,3-dione (PubChem CID 54102374) has the molecular formula C40H76O6 and a molecular weight of 653.04 g/mol. Its IUPAC name is (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-(7,8,8-trihexylhexadecan-7-yloxy)oxolane-2,3-dione.
| Compound Name | (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-(7,8,8-trihexylhexadecan-7-yloxy)oxolane-2,3-dione |
|---|---|
| PubChem CID | 54102374 |
| Molecular Formula | C40H76O6 |
| Molecular Weight | 653.04 g/mol |
| Exact Mass | 652.56 |
| IUPAC Name | (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-(7,8,8-trihexylhexadecan-7-yloxy)oxolane-2,3-dione |
| SMILES | CCCCCCCCC(CCCCCC)(CCCCCC)C(CCCCCC)(CCCCCC)OC1C(=O)C(=O)O[C@@H]1[C@@H](O)CO |
| InChI | InChI=1S/C40H76O6/c1-6-11-16-21-22-25-30-39(28-23-17-12-7-2,29-24-18-13-8-3)40(31-26-19-14-9-4,32-27-20-15-10-5)46-37-35(43)38(44)45-36(37)34(42)33-41/h34,36-37,41-42H,6-33H2,1-5H3/t34-,36+,37?/m0/s1 |
| InChIKey | NBKLHEJWUKNXQE-WYAHAJSASA-N |
| XLogP | 10.58 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.04 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|