C9H12O6 — CID 56623577
(5S)-5-[(1S)-1,3-dihydroxy-2,2-dimethylcyclopropyl]-4-hydroxyoxolane-2,3-dione (PubChem CID 56623577) has the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. Its IUPAC name is (5S)-5-[(1S)-1,3-dihydroxy-2,2-dimethylcyclopropyl]-4-hydroxyoxolane-2,3-dione.
| Compound Name | (5S)-5-[(1S)-1,3-dihydroxy-2,2-dimethylcyclopropyl]-4-hydroxyoxolane-2,3-dione |
|---|---|
| PubChem CID | 56623577 |
| Molecular Formula | C9H12O6 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | (5S)-5-[(1S)-1,3-dihydroxy-2,2-dimethylcyclopropyl]-4-hydroxyoxolane-2,3-dione |
| SMILES | CC1(C)C(O)[C@]1(O)[C@H]1OC(=O)C(=O)C1O |
| InChI | InChI=1S/C9H12O6/c1-8(2)7(13)9(8,14)5-3(10)4(11)6(12)15-5/h3,5,7,10,13-14H,1-2H3/t3?,5-,7?,9+/m0/s1 |
| InChIKey | QMQQVOSBTHRPCC-WEECQDETSA-N |
| XLogP | -2.03 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|