C15H26O7 — CID 123979358
(2R)-2-(3-hydroxypropoxy)-3,3-dimethyl-2-[(2R,3R)-2,3,4-trihydroxy-5-methylhexanoyl]cyclopropan-1-one (PubChem CID 123979358) has the molecular formula C15H26O7 and a molecular weight of 318.37 g/mol. Its IUPAC name is (2R)-2-(3-hydroxypropoxy)-3,3-dimethyl-2-[(2R,3R)-2,3,4-trihydroxy-5-methylhexanoyl]cyclopropan-1-one.
| Compound Name | (2R)-2-(3-hydroxypropoxy)-3,3-dimethyl-2-[(2R,3R)-2,3,4-trihydroxy-5-methylhexanoyl]cyclopropan-1-one |
|---|---|
| PubChem CID | 123979358 |
| Molecular Formula | C15H26O7 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (2R)-2-(3-hydroxypropoxy)-3,3-dimethyl-2-[(2R,3R)-2,3,4-trihydroxy-5-methylhexanoyl]cyclopropan-1-one |
| SMILES | CC(C)C(O)[C@@H](O)[C@@H](O)C(=O)[C@]1(OCCCO)C(=O)C1(C)C |
| InChI | InChI=1S/C15H26O7/c1-8(2)9(17)10(18)11(19)12(20)15(22-7-5-6-16)13(21)14(15,3)4/h8-11,16-19H,5-7H2,1-4H3/t9?,10-,11-,15+/m1/s1 |
| InChIKey | QYXLLXXAKSLENR-FCSAHWRLSA-N |
| XLogP | -0.96 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|