C15H28O5 — CID 15364770
ethyl (3R,5S)-5-tert-butyl-3,5-dihydroxy-4-oxononanoate (PubChem CID 15364770) has the molecular formula C15H28O5 and a molecular weight of 288.38 g/mol. Its IUPAC name is ethyl (3R,5S)-5-tert-butyl-3,5-dihydroxy-4-oxononanoate.
| Compound Name | ethyl (3R,5S)-5-tert-butyl-3,5-dihydroxy-4-oxononanoate |
|---|---|
| PubChem CID | 15364770 |
| Molecular Formula | C15H28O5 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | ethyl (3R,5S)-5-tert-butyl-3,5-dihydroxy-4-oxononanoate |
| SMILES | CCCC[C@@](O)(C(=O)[C@H](O)CC(=O)OCC)C(C)(C)C |
| InChI | InChI=1S/C15H28O5/c1-6-8-9-15(19,14(3,4)5)13(18)11(16)10-12(17)20-7-2/h11,16,19H,6-10H2,1-5H3/t11-,15-/m1/s1 |
| InChIKey | XEHSXKIUBGRXSP-IAQYHMDHSA-N |
| XLogP | 1.84 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |