C11H18O7 — CID 23631143
methyl 2-[(2S,3R,4R,5R,6S)-2-acetyl-3,4,5-trihydroxy-6-methyloxan-2-yl]acetate (PubChem CID 23631143) has the molecular formula C11H18O7 and a molecular weight of 262.26 g/mol. Its IUPAC name is methyl 2-[(2S,3R,4R,5R,6S)-2-acetyl-3,4,5-trihydroxy-6-methyloxan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,3R,4R,5R,6S)-2-acetyl-3,4,5-trihydroxy-6-methyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 23631143 |
| Molecular Formula | C11H18O7 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | methyl 2-[(2S,3R,4R,5R,6S)-2-acetyl-3,4,5-trihydroxy-6-methyloxan-2-yl]acetate |
| SMILES | COC(=O)C[C@]1(C(C)=O)O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H18O7/c1-5-8(14)9(15)10(16)11(18-5,6(2)12)4-7(13)17-3/h5,8-10,14-16H,4H2,1-3H3/t5-,8-,9+,10+,11+/m0/s1 |
| InChIKey | OEGYLNXYSNWKDD-CGUGROSYSA-N |
| XLogP | -1.62 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |