C12H20O6 — CID 54395697
(2S)-2-hydroxy-3,3-dimethyl-2-[(2S,3R)-2,3,4-trihydroxy-5-methylhexanoyl]cyclopropan-1-one (PubChem CID 54395697) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is (2S)-2-hydroxy-3,3-dimethyl-2-[(2S,3R)-2,3,4-trihydroxy-5-methylhexanoyl]cyclopropan-1-one.
| Compound Name | (2S)-2-hydroxy-3,3-dimethyl-2-[(2S,3R)-2,3,4-trihydroxy-5-methylhexanoyl]cyclopropan-1-one |
|---|---|
| PubChem CID | 54395697 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (2S)-2-hydroxy-3,3-dimethyl-2-[(2S,3R)-2,3,4-trihydroxy-5-methylhexanoyl]cyclopropan-1-one |
| SMILES | CC(C)C(O)[C@@H](O)[C@H](O)C(=O)[C@@]1(O)C(=O)C1(C)C |
| InChI | InChI=1S/C12H20O6/c1-5(2)6(13)7(14)8(15)9(16)12(18)10(17)11(12,3)4/h5-8,13-15,18H,1-4H3/t6?,7-,8+,12-/m1/s1 |
| InChIKey | VJTNZEWBFFCWKH-IPQYHECASA-N |
| XLogP | -1.37 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|