C22H34O11 — CID 87591557
(4R,5R,6S,7S)-5,6,7-triacetyl-3,4,5,6,7-pentahydroxyhexadecane-2,8,9-trione (PubChem CID 87591557) has the molecular formula C22H34O11 and a molecular weight of 474.50 g/mol. Its IUPAC name is (4R,5R,6S,7S)-5,6,7-triacetyl-3,4,5,6,7-pentahydroxyhexadecane-2,8,9-trione.
| Compound Name | (4R,5R,6S,7S)-5,6,7-triacetyl-3,4,5,6,7-pentahydroxyhexadecane-2,8,9-trione |
|---|---|
| PubChem CID | 87591557 |
| Molecular Formula | C22H34O11 |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | (4R,5R,6S,7S)-5,6,7-triacetyl-3,4,5,6,7-pentahydroxyhexadecane-2,8,9-trione |
| SMILES | CCCCCCCC(=O)C(=O)[C@@](O)(C(C)=O)[C@](O)(C(C)=O)[C@@](O)(C(C)=O)[C@H](O)C(O)C(C)=O |
| InChI | InChI=1S/C22H34O11/c1-6-7-8-9-10-11-16(27)18(29)20(31,13(3)24)22(33,15(5)26)21(32,14(4)25)19(30)17(28)12(2)23/h17,19,28,30-33H,6-11H2,1-5H3/t17?,19-,20+,21-,22-/m1/s1 |
| InChIKey | BXGCWTYHXORKAO-UAHLEYORSA-N |
| XLogP | -1.24 |
| TPSA | 203.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|