C11H16O6S2 — CID 541060
(6-acetyloxy-5-methoxy-3,3a,5,6,7,7a-hexahydrodithiolo[4,3-b]pyran-7-yl) acetate (PubChem CID 541060) has the molecular formula C11H16O6S2 and a molecular weight of 308.38 g/mol. Its IUPAC name is (6-acetyloxy-5-methoxy-3,3a,5,6,7,7a-hexahydrodithiolo[4,3-b]pyran-7-yl) acetate.
| Compound Name | (6-acetyloxy-5-methoxy-3,3a,5,6,7,7a-hexahydrodithiolo[4,3-b]pyran-7-yl) acetate |
|---|---|
| PubChem CID | 541060 |
| Molecular Formula | C11H16O6S2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | (6-acetyloxy-5-methoxy-3,3a,5,6,7,7a-hexahydrodithiolo[4,3-b]pyran-7-yl) acetate |
| SMILES | COC1OC2CSSC2C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C11H16O6S2/c1-5(12)15-8-9(16-6(2)13)11(14-3)17-7-4-18-19-10(7)8/h7-11H,4H2,1-3H3 |
| InChIKey | SXRLHEDLRGETHC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|