C10H19N — CID 54107181
(3R)-3-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline (PubChem CID 54107181) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is (3R)-3-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline.
| Compound Name | (3R)-3-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline |
|---|---|
| PubChem CID | 54107181 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (3R)-3-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline |
| SMILES | C[C@@H]1CC2CCCCC2CN1 |
| InChI | InChI=1S/C10H19N/c1-8-6-9-4-2-3-5-10(9)7-11-8/h8-11H,2-7H2,1H3/t8-,9?,10?/m1/s1 |
| InChIKey | NEOJGWWKIFBTJR-XNWIYYODSA-N |
| XLogP | 2.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |