C29H32N4O6 — CID 54109230
2-[4-[[2-cyclohexyl-4,7-bis(methoxymethoxy)imidazo[4,5-d]pyridazin-3-yl]methyl]phenyl]benzoic acid (PubChem CID 54109230) has the molecular formula C29H32N4O6 and a molecular weight of 532.60 g/mol. Its IUPAC name is 2-[4-[[2-cyclohexyl-4,7-bis(methoxymethoxy)imidazo[4,5-d]pyridazin-3-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[2-cyclohexyl-4,7-bis(methoxymethoxy)imidazo[4,5-d]pyridazin-3-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 54109230 |
| Molecular Formula | C29H32N4O6 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 2-[4-[[2-cyclohexyl-4,7-bis(methoxymethoxy)imidazo[4,5-d]pyridazin-3-yl]methyl]phenyl]benzoic acid |
| SMILES | COCOc1nnc(OCOC)c2c1nc(C1CCCCC1)n2Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C29H32N4O6/c1-36-17-38-27-24-25(28(32-31-27)39-18-37-2)33(26(30-24)21-8-4-3-5-9-21)16-19-12-14-20(15-13-19)22-10-6-7-11-23(22)29(34)35/h6-7,10-15,21H,3-5,8-9,16-18H2,1-2H3,(H,34,35) |
| InChIKey | NFXFBTGHMACWGQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|