C31H36N4O6 — CID 67947373
2-[4-[[2-cyclohexyl-4,7-bis(1-methoxyethoxy)imidazo[4,5-d]pyridazin-3-yl]methyl]phenyl]benzoic acid (PubChem CID 67947373) has the molecular formula C31H36N4O6 and a molecular weight of 560.65 g/mol. Its IUPAC name is 2-[4-[[2-cyclohexyl-4,7-bis(1-methoxyethoxy)imidazo[4,5-d]pyridazin-3-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[2-cyclohexyl-4,7-bis(1-methoxyethoxy)imidazo[4,5-d]pyridazin-3-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 67947373 |
| Molecular Formula | C31H36N4O6 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | 2-[4-[[2-cyclohexyl-4,7-bis(1-methoxyethoxy)imidazo[4,5-d]pyridazin-3-yl]methyl]phenyl]benzoic acid |
| SMILES | COC(C)Oc1nnc(OC(C)OC)c2c1nc(C1CCCCC1)n2Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C31H36N4O6/c1-19(38-3)40-29-26-27(30(34-33-29)41-20(2)39-4)35(28(32-26)23-10-6-5-7-11-23)18-21-14-16-22(17-15-21)24-12-8-9-13-25(24)31(36)37/h8-9,12-17,19-20,23H,5-7,10-11,18H2,1-4H3,(H,36,37) |
| InChIKey | BLQFKNUXYJYDFK-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|