C14H17NO — CID 5410936
(NE)-N-[(2E,6S)-2-benzylidene-6-methylcyclohexylidene]hydroxylamine (PubChem CID 5410936) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is (NE)-N-[(2E,6S)-2-benzylidene-6-methylcyclohexylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2E,6S)-2-benzylidene-6-methylcyclohexylidene]hydroxylamine |
|---|---|
| PubChem CID | 5410936 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (NE)-N-[(2E,6S)-2-benzylidene-6-methylcyclohexylidene]hydroxylamine |
| SMILES | C[C@H]1CCCC(=C\c2ccccc2)/C1=N/O |
| InChI | InChI=1S/C14H17NO/c1-11-6-5-9-13(14(11)15-16)10-12-7-3-2-4-8-12/h2-4,7-8,10-11,16H,5-6,9H2,1H3/b13-10+,15-14+/t11-/m0/s1 |
| InChIKey | SCVPFVRZISYFAS-PDTUNUPCSA-N |
| XLogP | 3.72 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|