C26H22N2O6 — CID 54109827
2,6-dibenzyl-4,8-bis(hydroxymethylidene)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrol (PubChem CID 54109827) has the molecular formula C26H22N2O6 and a molecular weight of 458.47 g/mol. Its IUPAC name is 2,6-dibenzyl-4,8-bis(hydroxymethylidene)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrol.
| Compound Name | 2,6-dibenzyl-4,8-bis(hydroxymethylidene)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrol |
|---|---|
| PubChem CID | 54109827 |
| Molecular Formula | C26H22N2O6 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 2,6-dibenzyl-4,8-bis(hydroxymethylidene)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrol |
| SMILES | OC=c1c2c(O)n(Cc3ccccc3)c(O)c2c(=CO)c2c(O)n(Cc3ccccc3)c(O)c12 |
| InChI | InChI=1S/C26H22N2O6/c29-13-17-19-20(24(32)27(23(19)31)11-15-7-3-1-4-8-15)18(14-30)22-21(17)25(33)28(26(22)34)12-16-9-5-2-6-10-16/h1-10,13-14,29-34H,11-12H2/b17-13-,18-14+ |
| InChIKey | NGHQRHCVTRZJLY-SIJTWYJSSA-N |
| XLogP | 3.11 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |