C21H30O6P2S — CID 54111184
1-[bis(diethoxyphosphoryl)methyl]-4-phenylsulfanylbenzene (PubChem CID 54111184) has the molecular formula C21H30O6P2S and a molecular weight of 472.48 g/mol. Its IUPAC name is 1-[bis(diethoxyphosphoryl)methyl]-4-phenylsulfanylbenzene.
| Compound Name | 1-[bis(diethoxyphosphoryl)methyl]-4-phenylsulfanylbenzene |
|---|---|
| PubChem CID | 54111184 |
| Molecular Formula | C21H30O6P2S |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 1-[bis(diethoxyphosphoryl)methyl]-4-phenylsulfanylbenzene |
| SMILES | CCOP(=O)(OCC)C(c1ccc(Sc2ccccc2)cc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C21H30O6P2S/c1-5-24-28(22,25-6-2)21(29(23,26-7-3)27-8-4)18-14-16-20(17-15-18)30-19-12-10-9-11-13-19/h9-17,21H,5-8H2,1-4H3 |
| InChIKey | NHEUANSTNHHJFM-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|