C11H16N4O5 — CID 54114401
methyl 6-[[(2-amino-1-cyano-2-oxoethylidene)amino]oxycarbonylamino]hexanoate (PubChem CID 54114401) has the molecular formula C11H16N4O5 and a molecular weight of 284.27 g/mol. Its IUPAC name is methyl 6-[[(2-amino-1-cyano-2-oxoethylidene)amino]oxycarbonylamino]hexanoate.
| Compound Name | methyl 6-[[(2-amino-1-cyano-2-oxoethylidene)amino]oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 54114401 |
| Molecular Formula | C11H16N4O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | methyl 6-[[(2-amino-1-cyano-2-oxoethylidene)amino]oxycarbonylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)ON=C(C#N)C(N)=O |
| InChI | InChI=1S/C11H16N4O5/c1-19-9(16)5-3-2-4-6-14-11(18)20-15-8(7-12)10(13)17/h2-6H2,1H3,(H2,13,17)(H,14,18) |
| InChIKey | NJINOMJPIZWCSJ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 143.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|