C18H18Cl2N2O3S2 — CID 54116967
2-chloro-5-[2-(2,4-dimethylphenyl)imino-4-hydroxy-3-methyl-1,3-thiazolidin-4-yl]benzenesulfonyl chloride (PubChem CID 54116967) has the molecular formula C18H18Cl2N2O3S2 and a molecular weight of 445.39 g/mol. Its IUPAC name is 2-chloro-5-[2-(2,4-dimethylphenyl)imino-4-hydroxy-3-methyl-1,3-thiazolidin-4-yl]benzenesulfonyl chloride.
| Compound Name | 2-chloro-5-[2-(2,4-dimethylphenyl)imino-4-hydroxy-3-methyl-1,3-thiazolidin-4-yl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 54116967 |
| Molecular Formula | C18H18Cl2N2O3S2 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | 2-chloro-5-[2-(2,4-dimethylphenyl)imino-4-hydroxy-3-methyl-1,3-thiazolidin-4-yl]benzenesulfonyl chloride |
| SMILES | Cc1ccc(/N=C2\SCC(O)(c3ccc(Cl)c(S(=O)(=O)Cl)c3)N2C)c(C)c1 |
| InChI | InChI=1S/C18H18Cl2N2O3S2/c1-11-4-7-15(12(2)8-11)21-17-22(3)18(23,10-26-17)13-5-6-14(19)16(9-13)27(20,24)25/h4-9,23H,10H2,1-3H3/b21-17- |
| InChIKey | NKZNEMHKBHJMHW-FXBPSFAMSA-N |
| XLogP | 4.40 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|