C12H11ClN4O — CID 54117233
2-[(2-chlorophenyl)diazenyl]-2-cyano-N-prop-2-enylacetamide (PubChem CID 54117233) has the molecular formula C12H11ClN4O and a molecular weight of 262.70 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)diazenyl]-2-cyano-N-prop-2-enylacetamide.
| Compound Name | 2-[(2-chlorophenyl)diazenyl]-2-cyano-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 54117233 |
| Molecular Formula | C12H11ClN4O |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-[(2-chlorophenyl)diazenyl]-2-cyano-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)C(C#N)/N=N/c1ccccc1Cl |
| InChI | InChI=1S/C12H11ClN4O/c1-2-7-15-12(18)11(8-14)17-16-10-6-4-3-5-9(10)13/h2-6,11H,1,7H2,(H,15,18)/b17-16+ |
| InChIKey | NLECUSCGLDIRRT-WUKNDPDISA-N |
| XLogP | 2.62 |
| TPSA | 77.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|