C11H11N3O — CID 97253742
(2S)-2-cyano-N-prop-2-enyl-2-pyridin-2-ylacetamide (PubChem CID 97253742) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is (2S)-2-cyano-N-prop-2-enyl-2-pyridin-2-ylacetamide.
| Compound Name | (2S)-2-cyano-N-prop-2-enyl-2-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 97253742 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | (2S)-2-cyano-N-prop-2-enyl-2-pyridin-2-ylacetamide |
| SMILES | C=CCNC(=O)[C@H](C#N)c1ccccn1 |
| InChI | InChI=1S/C11H11N3O/c1-2-6-14-11(15)9(8-12)10-5-3-4-7-13-10/h2-5,7,9H,1,6H2,(H,14,15)/t9-/m1/s1 |
| InChIKey | FZMULNDTDPGIRV-SECBINFHSA-N |
| XLogP | 0.99 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|