C18H15N3O2 — CID 94217607
4-[(E,4R)-4-cyano-3-oxo-4-pyridin-2-ylbut-1-enyl]-N-methylbenzamide (PubChem CID 94217607) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 4-[(E,4R)-4-cyano-3-oxo-4-pyridin-2-ylbut-1-enyl]-N-methylbenzamide.
| Compound Name | 4-[(E,4R)-4-cyano-3-oxo-4-pyridin-2-ylbut-1-enyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 94217607 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-[(E,4R)-4-cyano-3-oxo-4-pyridin-2-ylbut-1-enyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(/C=C/C(=O)[C@@H](C#N)c2ccccn2)cc1 |
| InChI | InChI=1S/C18H15N3O2/c1-20-18(23)14-8-5-13(6-9-14)7-10-17(22)15(12-19)16-4-2-3-11-21-16/h2-11,15H,1H3,(H,20,23)/b10-7+/t15-/m0/s1 |
| InChIKey | NQNYDJPDAZSDFP-VSGCLNPGSA-N |
| XLogP | 2.33 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|