C20H23N5O10S2 — CID 54119487
[2-(methoxymethoxy)-2-oxoethyl] (6R,7R)-3-(acetyloxymethyl)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54119487) has the molecular formula C20H23N5O10S2 and a molecular weight of 557.56 g/mol. Its IUPAC name is [2-(methoxymethoxy)-2-oxoethyl] (6R,7R)-3-(acetyloxymethyl)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | [2-(methoxymethoxy)-2-oxoethyl] (6R,7R)-3-(acetyloxymethyl)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54119487 |
| Molecular Formula | C20H23N5O10S2 |
| Molecular Weight | 557.56 g/mol |
| Exact Mass | 557.09 |
| IUPAC Name | [2-(methoxymethoxy)-2-oxoethyl] (6R,7R)-3-(acetyloxymethyl)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COCOC(=O)COC(=O)C1=C(COC(C)=O)CS[C@@H]2[C@H](NC(=O)C(=NOC)c3csc(N)n3)C(=O)N12 |
| InChI | InChI=1S/C20H23N5O10S2/c1-9(26)33-4-10-6-36-18-14(23-16(28)13(24-32-3)11-7-37-20(21)22-11)17(29)25(18)15(10)19(30)34-5-12(27)35-8-31-2/h7,14,18H,4-6,8H2,1-3H3,(H2,21,22)(H,23,28)/t14-,18-/m1/s1 |
| InChIKey | NMQFPYKWBPYGCP-RDTXWAMCSA-N |
| XLogP | -1.02 |
| TPSA | 198.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.56 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|