C19H25N5O7S2 — CID 88660459
propan-2-yloxymethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88660459) has the molecular formula C19H25N5O7S2 and a molecular weight of 499.57 g/mol. Its IUPAC name is propan-2-yloxymethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | propan-2-yloxymethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88660459 |
| Molecular Formula | C19H25N5O7S2 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | propan-2-yloxymethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COCC1=C(C(=O)OCOC(C)C)N2C(=O)C(NC(=O)C(=NOC)c3csc(N)n3)[C@@H]2SC1 |
| InChI | InChI=1S/C19H25N5O7S2/c1-9(2)30-8-31-18(27)14-10(5-28-3)6-32-17-13(16(26)24(14)17)22-15(25)12(23-29-4)11-7-33-19(20)21-11/h7,9,13,17H,5-6,8H2,1-4H3,(H2,20,21)(H,22,25)/t13?,17-/m0/s1 |
| InChIKey | YYBPRJFCLRLNTR-RUINGEJQSA-N |
| XLogP | 0.30 |
| TPSA | 154.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|