C18H21N5O8S2 — CID 88723216
propanoyloxymethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88723216) has the molecular formula C18H21N5O8S2 and a molecular weight of 499.53 g/mol. Its IUPAC name is propanoyloxymethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | propanoyloxymethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88723216 |
| Molecular Formula | C18H21N5O8S2 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | propanoyloxymethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCC(=O)OCOC(=O)C1=C(COC)CS[C@H]2C(NC(=O)C(=NO)c3csc(N)n3)C(=O)N12 |
| InChI | InChI=1S/C18H21N5O8S2/c1-3-10(24)30-7-31-17(27)13-8(4-29-2)5-32-16-12(15(26)23(13)16)21-14(25)11(22-28)9-6-33-18(19)20-9/h6,12,16,28H,3-5,7H2,1-2H3,(H2,19,20)(H,21,25)/t12?,16-/m0/s1 |
| InChIKey | LWUJLPWHZPIIJK-INSVYWFGSA-N |
| XLogP | -0.34 |
| TPSA | 182.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|