C21H20ClN5O6S2 — CID 10459871
(4-methoxyphenyl)methyl (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 10459871) has the molecular formula C21H20ClN5O6S2 and a molecular weight of 538.01 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 10459871 |
| Molecular Formula | C21H20ClN5O6S2 |
| Molecular Weight | 538.01 g/mol |
| Exact Mass | 537.05 |
| IUPAC Name | (4-methoxyphenyl)methyl (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COc1ccc(COC(=O)C2=C(CCl)CS[C@@H]3[C@H](NC(=O)/C(=N\O)c4csc(N)n4)C(=O)N23)cc1 |
| InChI | InChI=1S/C21H20ClN5O6S2/c1-32-12-4-2-10(3-5-12)7-33-20(30)16-11(6-22)8-34-19-15(18(29)27(16)19)25-17(28)14(26-31)13-9-35-21(23)24-13/h2-5,9,15,19,31H,6-8H2,1H3,(H2,23,24)(H,25,28)/b26-14-/t15-,19-/m1/s1 |
| InChIKey | LVOPKUDVPUXXLW-ARLAXHMGSA-N |
| XLogP | 1.55 |
| TPSA | 156.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.01 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|