C20H25N5O8S2 — CID 88724853
pentanoyloxymethyl (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88724853) has the molecular formula C20H25N5O8S2 and a molecular weight of 527.58 g/mol. Its IUPAC name is pentanoyloxymethyl (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | pentanoyloxymethyl (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88724853 |
| Molecular Formula | C20H25N5O8S2 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | pentanoyloxymethyl (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCCCC(=O)OCOC(=O)C1=C(COC)CS[C@@H]2C(NC(=O)/C(=N\O)c3csc(N)n3)C(=O)N12 |
| InChI | InChI=1S/C20H25N5O8S2/c1-3-4-5-12(26)32-9-33-19(29)15-10(6-31-2)7-34-18-14(17(28)25(15)18)23-16(27)13(24-30)11-8-35-20(21)22-11/h8,14,18,30H,3-7,9H2,1-2H3,(H2,21,22)(H,23,27)/b24-13-/t14?,18-/m1/s1 |
| InChIKey | IFDKDTFLWSXHSE-PSNFNZHJSA-N |
| XLogP | 0.44 |
| TPSA | 182.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|