C20H25N5O7S3 — CID 154424424
pentanoyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 154424424) has the molecular formula C20H25N5O7S3 and a molecular weight of 543.65 g/mol. Its IUPAC name is pentanoyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | pentanoyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 154424424 |
| Molecular Formula | C20H25N5O7S3 |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.09 |
| IUPAC Name | pentanoyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCCCC(=O)OCOC(=O)C1=C(CSC)CS[C@@H]2C(NC(=O)C(=NO)c3csc(N)n3)C(=O)N12 |
| InChI | InChI=1S/C20H25N5O7S3/c1-3-4-5-12(26)31-9-32-19(29)15-10(6-33-2)7-34-18-14(17(28)25(15)18)23-16(27)13(24-30)11-8-35-20(21)22-11/h8,14,18,30H,3-7,9H2,1-2H3,(H2,21,22)(H,23,27)/t14?,18-/m1/s1 |
| InChIKey | HXFSAUMZAHLBQZ-XPKAQORNSA-N |
| XLogP | 1.15 |
| TPSA | 173.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|