C22H29N5O9S2 — CID 88659444
1-butan-2-yloxycarbonyloxyethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88659444) has the molecular formula C22H29N5O9S2 and a molecular weight of 571.63 g/mol. Its IUPAC name is 1-butan-2-yloxycarbonyloxyethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 1-butan-2-yloxycarbonyloxyethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88659444 |
| Molecular Formula | C22H29N5O9S2 |
| Molecular Weight | 571.63 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | 1-butan-2-yloxycarbonyloxyethyl (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCC(C)OC(=O)OC(C)OC(=O)C1=C(COC)CS[C@H]2C(NC(=O)C(=NOC)c3csc(N)n3)C(=O)N12 |
| InChI | InChI=1S/C22H29N5O9S2/c1-6-10(2)34-22(31)36-11(3)35-20(30)16-12(7-32-4)8-37-19-15(18(29)27(16)19)25-17(28)14(26-33-5)13-9-38-21(23)24-13/h9-11,15,19H,6-8H2,1-5H3,(H2,23,24)(H,25,28)/t10?,11?,15?,19-/m0/s1 |
| InChIKey | TWEQMNXNUVGYFI-ZUOARDSHSA-N |
| XLogP | 1.22 |
| TPSA | 180.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.63 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|