C15H19NO4 — CID 54119529
1-ethoxy-2-methoxy-4-[(1S,6R)-6-nitrocyclohex-3-en-1-yl]benzene (PubChem CID 54119529) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 1-ethoxy-2-methoxy-4-[(1S,6R)-6-nitrocyclohex-3-en-1-yl]benzene.
| Compound Name | 1-ethoxy-2-methoxy-4-[(1S,6R)-6-nitrocyclohex-3-en-1-yl]benzene |
|---|---|
| PubChem CID | 54119529 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 1-ethoxy-2-methoxy-4-[(1S,6R)-6-nitrocyclohex-3-en-1-yl]benzene |
| SMILES | CCOc1ccc([C@@H]2CC=CC[C@H]2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C15H19NO4/c1-3-20-14-9-8-11(10-15(14)19-2)12-6-4-5-7-13(12)16(17)18/h4-5,8-10,12-13H,3,6-7H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | NMQXARRVUBTFJP-QWHCGFSZSA-N |
| XLogP | 3.17 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|