C12H9N3O3 — CID 54119825
4-hydroxy-3H-pyrido[3,2-f]quinoxaline-3-carboxylic acid (PubChem CID 54119825) has the molecular formula C12H9N3O3 and a molecular weight of 243.22 g/mol. Its IUPAC name is 4-hydroxy-3H-pyrido[3,2-f]quinoxaline-3-carboxylic acid.
| Compound Name | 4-hydroxy-3H-pyrido[3,2-f]quinoxaline-3-carboxylic acid |
|---|---|
| PubChem CID | 54119825 |
| Molecular Formula | C12H9N3O3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 4-hydroxy-3H-pyrido[3,2-f]quinoxaline-3-carboxylic acid |
| SMILES | O=C(O)C1C=Nc2c(ccc3ncccc23)N1O |
| InChI | InChI=1S/C12H9N3O3/c16-12(17)10-6-14-11-7-2-1-5-13-8(7)3-4-9(11)15(10)18/h1-6,10,18H,(H,16,17) |
| InChIKey | NMWCFONGCNSPFX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |