About [2-(3-methylphenoxy)phenyl] 2-methoxyiminoacetate
[2-(3-methylphenoxy)phenyl] 2-methoxyiminoacetate (PubChem CID 54120371) has the molecular formula C16H15NO4
and a molecular weight of 285.30 g/mol. Its IUPAC name is [2-(3-methylphenoxy)phenyl] 2-methoxyiminoacetate.
Molecular Properties
| Compound Name | [2-(3-methylphenoxy)phenyl] 2-methoxyiminoacetate |
| PubChem CID | 54120371 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | [2-(3-methylphenoxy)phenyl] 2-methoxyiminoacetate |
| SMILES | CON=CC(=O)Oc1ccccc1Oc1cccc(C)c1 |
| InChI | InChI=1S/C16H15NO4/c1-12-6-5-7-13(10-12)20-14-8-3-4-9-15(14)21-16(18)11-17-19-2/h3-11H,1-2H3 |
| InChIKey | NNGQKLKIJGLFRQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(3-methylphenoxy)phenyl] 2-methoxyiminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-methylphenoxy)phenyl] 2-methoxyiminoacetate?
The IUPAC name of [2-(3-methylphenoxy)phenyl] 2-methoxyiminoacetate (CID 54120371) is [2-(3-methylphenoxy)phenyl] 2-methoxyiminoacetate.
What is the SMILES notation for [2-(3-methylphenoxy)phenyl] 2-methoxyiminoacetate?
The canonical SMILES for [2-(3-methylphenoxy)phenyl] 2-methoxyiminoacetate is CON=CC(=O)Oc1ccccc1Oc1cccc(C)c1.
What is the InChIKey of [2-(3-methylphenoxy)phenyl] 2-methoxyiminoacetate?
The InChIKey is NNGQKLKIJGLFRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO4/c1-12-6-5-7-13(10-12)20-14-8-3-4-9-15(14)21-16(18)11-17-19-2/h3-11H,1-2H3.
What are the key properties of [2-(3-methylphenoxy)phenyl] 2-methoxyiminoacetate?
[2-(3-methylphenoxy)phenyl] 2-methoxyiminoacetate has a molecular weight of 285.30 g/mol, XLogP of 3.32, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-methylphenoxy)phenyl] 2-methoxyiminoacetate is sourced from PubChem (CID 54120371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).