C26H33BrN2O6 — CID 54122194
diethyl 4-[2-(2-bromo-3-ethoxy-3-oxoprop-1-enyl)phenyl]-6-[(dimethylamino)methyl]-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54122194) has the molecular formula C26H33BrN2O6 and a molecular weight of 549.46 g/mol. Its IUPAC name is diethyl 4-[2-(2-bromo-3-ethoxy-3-oxoprop-1-enyl)phenyl]-6-[(dimethylamino)methyl]-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-[2-(2-bromo-3-ethoxy-3-oxoprop-1-enyl)phenyl]-6-[(dimethylamino)methyl]-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54122194 |
| Molecular Formula | C26H33BrN2O6 |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | diethyl 4-[2-(2-bromo-3-ethoxy-3-oxoprop-1-enyl)phenyl]-6-[(dimethylamino)methyl]-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C(Br)=Cc1ccccc1C1C(C(=O)OCC)=C(CN(C)C)N=C(C)C1C(=O)OCC |
| InChI | InChI=1S/C26H33BrN2O6/c1-7-33-24(30)19(27)14-17-12-10-11-13-18(17)22-21(25(31)34-8-2)16(4)28-20(15-29(5)6)23(22)26(32)35-9-3/h10-14,21-22H,7-9,15H2,1-6H3 |
| InChIKey | NOMJKEKTLZZQJY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|