C28H38N2O6 — CID 54425273
diethyl 6-[(dimethylamino)methyl]-4-[2-(2-ethoxycarbonylbut-1-enyl)phenyl]-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54425273) has the molecular formula C28H38N2O6 and a molecular weight of 498.62 g/mol. Its IUPAC name is diethyl 6-[(dimethylamino)methyl]-4-[2-(2-ethoxycarbonylbut-1-enyl)phenyl]-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 6-[(dimethylamino)methyl]-4-[2-(2-ethoxycarbonylbut-1-enyl)phenyl]-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54425273 |
| Molecular Formula | C28H38N2O6 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | diethyl 6-[(dimethylamino)methyl]-4-[2-(2-ethoxycarbonylbut-1-enyl)phenyl]-2-methyl-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C(=Cc1ccccc1C1C(C(=O)OCC)=C(CN(C)C)N=C(C)C1C(=O)OCC)CC |
| InChI | InChI=1S/C28H38N2O6/c1-8-19(26(31)34-9-2)16-20-14-12-13-15-21(20)24-23(27(32)35-10-3)18(5)29-22(17-30(6)7)25(24)28(33)36-11-4/h12-16,23-24H,8-11,17H2,1-7H3 |
| InChIKey | WDQLJHJDYKDTQE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|