C15H21N3S — CID 54127129
2-[2-(6-piperidin-1-yl-2-pyridinyl)ethyl]-3H-1,2-thiazole (PubChem CID 54127129) has the molecular formula C15H21N3S and a molecular weight of 275.42 g/mol. Its IUPAC name is 2-[2-(6-piperidin-1-yl-2-pyridinyl)ethyl]-3H-1,2-thiazole.
| Compound Name | 2-[2-(6-piperidin-1-yl-2-pyridinyl)ethyl]-3H-1,2-thiazole |
|---|---|
| PubChem CID | 54127129 |
| Molecular Formula | C15H21N3S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-[2-(6-piperidin-1-yl-2-pyridinyl)ethyl]-3H-1,2-thiazole |
| SMILES | C1=CSN(CCc2cccc(N3CCCCC3)n2)C1 |
| InChI | InChI=1S/C15H21N3S/c1-2-9-17(10-3-1)15-7-4-6-14(16-15)8-12-18-11-5-13-19-18/h4-7,13H,1-3,8-12H2 |
| InChIKey | NRTJHCOHOHKBEZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|