C12H20N4 — CID 62300509
[6-(4-methyl-1,4-diazepan-1-yl)-2-pyridinyl]methanamine (PubChem CID 62300509) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is [6-(4-methyl-1,4-diazepan-1-yl)-2-pyridinyl]methanamine.
| Compound Name | [6-(4-methyl-1,4-diazepan-1-yl)-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 62300509 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | [6-(4-methyl-1,4-diazepan-1-yl)-2-pyridinyl]methanamine |
| SMILES | CN1CCCN(c2cccc(CN)n2)CC1 |
| InChI | InChI=1S/C12H20N4/c1-15-6-3-7-16(9-8-15)12-5-2-4-11(10-13)14-12/h2,4-5H,3,6-10,13H2,1H3 |
| InChIKey | WIRURXRQXYUYKZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |