C17H9F4N5O — CID 54127536
N-[4-[5-cyano-3-(trifluoromethyl)pyrazol-1-yl]phenyl]-2-fluoropyridine-3-carboxamide (PubChem CID 54127536) has the molecular formula C17H9F4N5O and a molecular weight of 375.29 g/mol. Its IUPAC name is N-[4-[5-cyano-3-(trifluoromethyl)pyrazol-1-yl]phenyl]-2-fluoropyridine-3-carboxamide.
| Compound Name | N-[4-[5-cyano-3-(trifluoromethyl)pyrazol-1-yl]phenyl]-2-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 54127536 |
| Molecular Formula | C17H9F4N5O |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | N-[4-[5-cyano-3-(trifluoromethyl)pyrazol-1-yl]phenyl]-2-fluoropyridine-3-carboxamide |
| SMILES | N#Cc1cc(C(F)(F)F)nn1-c1ccc(NC(=O)c2cccnc2F)cc1 |
| InChI | InChI=1S/C17H9F4N5O/c18-15-13(2-1-7-23-15)16(27)24-10-3-5-11(6-4-10)26-12(9-22)8-14(25-26)17(19,20)21/h1-8H,(H,24,27) |
| InChIKey | NSASFMNURYHKNH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|